C16H15N3O2 — CID 115393476
3-(3,5-dimethoxyphenyl)-4-phenyl-1,2,4-triazole (PubChem CID 115393476) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(3,5-dimethoxyphenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393476 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-4-phenyl-1,2,4-triazole |
| SMILES | COc1cc(OC)cc(-c2nncn2-c2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O2/c1-20-14-8-12(9-15(10-14)21-2)16-18-17-11-19(16)13-6-4-3-5-7-13/h3-11H,1-2H3 |
| InChIKey | UAVZPQOKKZAVDU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |