C16H13N3O — CID 115393480
3-(2,3-dihydro-1-benzofuran-5-yl)-4-phenyl-1,2,4-triazole (PubChem CID 115393480) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393480 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(-n2cnnc2-c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C16H13N3O/c1-2-4-14(5-3-1)19-11-17-18-16(19)13-6-7-15-12(10-13)8-9-20-15/h1-7,10-11H,8-9H2 |
| InChIKey | JAODGKIQCNFJKP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |