C18H16N2O — CID 58947269
2-(2,3-dihydro-1-benzofuran-5-yl)-1-(2-methylphenyl)imidazole (PubChem CID 58947269) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-1-(2-methylphenyl)imidazole.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1-(2-methylphenyl)imidazole |
|---|---|
| PubChem CID | 58947269 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-1-(2-methylphenyl)imidazole |
| SMILES | Cc1ccccc1-n1ccnc1-c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C18H16N2O/c1-13-4-2-3-5-16(13)20-10-9-19-18(20)15-6-7-17-14(12-15)8-11-21-17/h2-7,9-10,12H,8,11H2,1H3 |
| InChIKey | PHKFQSWIINSQPE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |