C14H19N3O2 — CID 115394609
4-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-triazole (PubChem CID 115394609) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115394609 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-triazole |
| SMILES | COc1cc(OC)cc(-c2nncn2C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(2,3)17-9-15-16-13(17)10-6-11(18-4)8-12(7-10)19-5/h6-9H,1-5H3 |
| InChIKey | CNMPELHCVLWNOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |