C12H15N3O2 — CID 113300999
4-(2-methoxyethyl)-3-(3-methoxyphenyl)-1,2,4-triazole (PubChem CID 113300999) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-(3-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-(2-methoxyethyl)-3-(3-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113300999 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-(2-methoxyethyl)-3-(3-methoxyphenyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C12H15N3O2/c1-16-7-6-15-9-13-14-12(15)10-4-3-5-11(8-10)17-2/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | OGQRTQMGMXEGBS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |