C9H11N3OS — CID 115393515
4-(2-methoxyethyl)-3-thiophen-3-yl-1,2,4-triazole (PubChem CID 115393515) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-thiophen-3-yl-1,2,4-triazole.
| Compound Name | 4-(2-methoxyethyl)-3-thiophen-3-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393515 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-(2-methoxyethyl)-3-thiophen-3-yl-1,2,4-triazole |
| SMILES | COCCn1cnnc1-c1ccsc1 |
| InChI | InChI=1S/C9H11N3OS/c1-13-4-3-12-7-10-11-9(12)8-2-5-14-6-8/h2,5-7H,3-4H2,1H3 |
| InChIKey | FDSTWDFSKZCGMD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |