C11H11F2N3O — CID 113301014
3-(2,5-difluorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 113301014) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-(2,5-difluorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113301014 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-(2,5-difluorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C11H11F2N3O/c1-17-5-4-16-7-14-15-11(16)9-6-8(12)2-3-10(9)13/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | TXERAILNAUYOEQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |