C11H11BrClN3O — CID 115393754
3-(5-bromo-2-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 115393754) has the molecular formula C11H11BrClN3O and a molecular weight of 316.59 g/mol. Its IUPAC name is 3-(5-bromo-2-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-(5-bromo-2-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115393754 |
| Molecular Formula | C11H11BrClN3O |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 3-(5-bromo-2-chlorophenyl)-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1-c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H11BrClN3O/c1-17-5-4-16-7-14-15-11(16)9-6-8(12)2-3-10(9)13/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | CXWQYVPWTYGKBB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |