C12H7Br2N3S — CID 113300923
3-(4,5-dibromothiophen-2-yl)-4-phenyl-1,2,4-triazole (PubChem CID 113300923) has the molecular formula C12H7Br2N3S and a molecular weight of 385.08 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 113300923 |
| Molecular Formula | C12H7Br2N3S |
| Molecular Weight | 385.08 g/mol |
| Exact Mass | 382.87 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-4-phenyl-1,2,4-triazole |
| SMILES | Brc1cc(-c2nncn2-c2ccccc2)sc1Br |
| InChI | InChI=1S/C12H7Br2N3S/c13-9-6-10(18-11(9)14)12-16-15-7-17(12)8-4-2-1-3-5-8/h1-7H |
| InChIKey | IUFSAKFMZWUOOE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |