C8H7Br2N3S — CID 115394687
3-(4,5-dibromothiophen-2-yl)-4-ethyl-1,2,4-triazole (PubChem CID 115394687) has the molecular formula C8H7Br2N3S and a molecular weight of 337.04 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115394687 |
| Molecular Formula | C8H7Br2N3S |
| Molecular Weight | 337.04 g/mol |
| Exact Mass | 334.87 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-4-ethyl-1,2,4-triazole |
| SMILES | CCn1cnnc1-c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H7Br2N3S/c1-2-13-4-11-12-8(13)6-3-5(9)7(10)14-6/h3-4H,2H2,1H3 |
| InChIKey | IQXVJPHCQSGIPS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.04 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |