C7H8N4S — CID 115394689
4-(4-ethyl-1,2,4-triazol-3-yl)-1,3-thiazole (PubChem CID 115394689) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 4-(4-ethyl-1,2,4-triazol-3-yl)-1,3-thiazole.
| Compound Name | 4-(4-ethyl-1,2,4-triazol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 115394689 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-(4-ethyl-1,2,4-triazol-3-yl)-1,3-thiazole |
| SMILES | CCn1cnnc1-c1cscn1 |
| InChI | InChI=1S/C7H8N4S/c1-2-11-4-9-10-7(11)6-3-12-5-8-6/h3-5H,2H2,1H3 |
| InChIKey | PVBUNDJTFKKWHA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |