C6H7N5S — CID 115394758
4-(4-ethyl-1,2,4-triazol-3-yl)thiadiazole (PubChem CID 115394758) has the molecular formula C6H7N5S and a molecular weight of 181.22 g/mol. Its IUPAC name is 4-(4-ethyl-1,2,4-triazol-3-yl)thiadiazole.
| Compound Name | 4-(4-ethyl-1,2,4-triazol-3-yl)thiadiazole |
|---|---|
| PubChem CID | 115394758 |
| Molecular Formula | C6H7N5S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 4-(4-ethyl-1,2,4-triazol-3-yl)thiadiazole |
| SMILES | CCn1cnnc1-c1csnn1 |
| InChI | InChI=1S/C6H7N5S/c1-2-11-4-7-9-6(11)5-3-12-10-8-5/h3-4H,2H2,1H3 |
| InChIKey | NZRFFBHGYWVXOT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |