C10H12N4 — CID 115394967
2-(4-propyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 115394967) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(4-propyl-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 2-(4-propyl-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 115394967 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-(4-propyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | CCCn1cnnc1-c1ccccn1 |
| InChI | InChI=1S/C10H12N4/c1-2-7-14-8-12-13-10(14)9-5-3-4-6-11-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | QTJJXKGMMIDYHV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |