C11H13ClN4 — CID 63724131
3-chloro-2-(4-propyl-1,2,4-triazol-3-yl)aniline (PubChem CID 63724131) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 3-chloro-2-(4-propyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 3-chloro-2-(4-propyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 63724131 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-chloro-2-(4-propyl-1,2,4-triazol-3-yl)aniline |
| SMILES | CCCn1cnnc1-c1c(N)cccc1Cl |
| InChI | InChI=1S/C11H13ClN4/c1-2-6-16-7-14-15-11(16)10-8(12)4-3-5-9(10)13/h3-5,7H,2,6,13H2,1H3 |
| InChIKey | VUJACQGGBRCETQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|