C11H11ClFN3 — CID 115395003
3-(3-chloro-2-fluorophenyl)-4-propyl-1,2,4-triazole (PubChem CID 115395003) has the molecular formula C11H11ClFN3 and a molecular weight of 239.68 g/mol. Its IUPAC name is 3-(3-chloro-2-fluorophenyl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(3-chloro-2-fluorophenyl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115395003 |
| Molecular Formula | C11H11ClFN3 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-(3-chloro-2-fluorophenyl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1cnnc1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C11H11ClFN3/c1-2-6-16-7-14-15-11(16)8-4-3-5-9(12)10(8)13/h3-5,7H,2,6H2,1H3 |
| InChIKey | DTIMJEOJQKWVKI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |