C11H8F5N3 — CID 115395009
3-(2,3,4,5,6-pentafluorophenyl)-4-propyl-1,2,4-triazole (PubChem CID 115395009) has the molecular formula C11H8F5N3 and a molecular weight of 277.20 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-4-propyl-1,2,4-triazole.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-4-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115395009 |
| Molecular Formula | C11H8F5N3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-4-propyl-1,2,4-triazole |
| SMILES | CCCn1cnnc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5N3/c1-2-3-19-4-17-18-11(19)5-6(12)8(14)10(16)9(15)7(5)13/h4H,2-3H2,1H3 |
| InChIKey | LOFQRSJFTDTLPO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|