C9H4F5N3 — CID 115395285
4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazole (PubChem CID 115395285) has the molecular formula C9H4F5N3 and a molecular weight of 249.14 g/mol. Its IUPAC name is 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazole.
| Compound Name | 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115395285 |
| Molecular Formula | C9H4F5N3 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-1,2,4-triazole |
| SMILES | Cn1cnnc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H4F5N3/c1-17-2-15-16-9(17)3-4(10)6(12)8(14)7(13)5(3)11/h2H,1H3 |
| InChIKey | ZZIWDOWUXZXZFI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|