C6H13N3S — CID 91546517
ethane;4-methyl-3-methylsulfanyl-1,2,4-triazole (PubChem CID 91546517) has the molecular formula C6H13N3S and a molecular weight of 159.26 g/mol. Its IUPAC name is ethane;4-methyl-3-methylsulfanyl-1,2,4-triazole.
| Compound Name | ethane;4-methyl-3-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 91546517 |
| Molecular Formula | C6H13N3S |
| Molecular Weight | 159.26 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | ethane;4-methyl-3-methylsulfanyl-1,2,4-triazole |
| SMILES | CC.CSc1nncn1C |
| InChI | InChI=1S/C4H7N3S.C2H6/c1-7-3-5-6-4(7)8-2;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | KDKQRRAUXCVITK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |