C6H10N4OS — CID 60626094
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 60626094) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 60626094 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nncn1C)C(N)=O |
| InChI | InChI=1S/C6H10N4OS/c1-4(5(7)11)12-6-9-8-3-10(6)2/h3-4H,1-2H3,(H2,7,11) |
| InChIKey | UAQXIYOBOUZQFB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |