About 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid (PubChem CID 45134923) has the molecular formula C5H8N4O2S
and a molecular weight of 188.21 g/mol. Its IUPAC name is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid.
Analyze 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid?
The IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid (CID 45134923) is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid.
What is the SMILES notation for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid?
The canonical SMILES for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid is CC(Sc1nncn1N)C(=O)O.
What is the InChIKey of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid?
The InChIKey is VSUXEUIJCORLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2S/c1-3(4(10)11)12-5-8-7-2-9(5)6/h2-3H,6H2,1H3,(H,10,11).
What are the key properties of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid?
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid has a molecular weight of 188.21 g/mol, XLogP of -0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]propanoic acid is sourced from PubChem (CID 45134923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).