About 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid (PubChem CID 60708323) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid.
Analyze 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid?
The IUPAC name of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid (CID 60708323) is 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid.
What is the SMILES notation for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid?
The canonical SMILES for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid is Nn1cnnc1SC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid?
The InChIKey is SVSDTMATPVQZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S/c11-14-6-12-13-10(14)17-8(9(15)16)7-4-2-1-3-5-7/h1-6,8H,11H2,(H,15,16).
What are the key properties of 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid?
2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid has a molecular weight of 250.28 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,4-triazol-3-yl)sulfanyl]-2-phenylacetic acid is sourced from PubChem (CID 60708323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).