C16H13N3O2S — CID 134095383
2-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 134095383) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
| Compound Name | 2-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 134095383 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)C(Sc1ncn(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2S/c20-15(21)14(12-7-3-1-4-8-12)22-16-17-11-19(18-16)13-9-5-2-6-10-13/h1-11,14H,(H,20,21) |
| InChIKey | QPWXELNAEPMPRL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |