C18H18N4OS — CID 18134460
N-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide (PubChem CID 18134460) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide.
| Compound Name | N-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 18134460 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-phenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1ncn(-c2ccccc2)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H18N4OS/c1-2-16(17(23)20-14-9-5-3-6-10-14)24-18-19-13-22(21-18)15-11-7-4-8-12-15/h3-13,16H,2H2,1H3,(H,20,23) |
| InChIKey | INLPXCVXRYRKDM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |