C12H13N5O2S — CID 16587163
N-carbamoyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 16587163) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is N-carbamoyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-carbamoyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 16587163 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-carbamoyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1ncn(-c2ccccc2)n1)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H13N5O2S/c1-8(10(18)15-11(13)19)20-12-14-7-17(16-12)9-5-3-2-4-6-9/h2-8H,1H3,(H3,13,15,18,19) |
| InChIKey | HBAOXYNITOQJCN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |