C8H10N4O2S — CID 8024239
(2S)-N-carbamoyl-2-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 8024239) has the molecular formula C8H10N4O2S and a molecular weight of 226.26 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | (2S)-N-carbamoyl-2-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 8024239 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (2S)-N-carbamoyl-2-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | C[C@H](Sc1ncccn1)C(=O)NC(N)=O |
| InChI | InChI=1S/C8H10N4O2S/c1-5(6(13)12-7(9)14)15-8-10-3-2-4-11-8/h2-5H,1H3,(H3,9,12,13,14)/t5-/m0/s1 |
| InChIKey | OOCRXBGNMXRZOD-YFKPBYRVSA-N |
| XLogP | 0.15 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |