C15H18N4OS — CID 18158323
2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylbutanamide (PubChem CID 18158323) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylbutanamide.
| Compound Name | 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylbutanamide |
|---|---|
| PubChem CID | 18158323 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[(5-cyclopropyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-phenylbutanamide |
| SMILES | CCC(Sc1n[nH]c(C2CC2)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H18N4OS/c1-2-12(14(20)16-11-6-4-3-5-7-11)21-15-17-13(18-19-15)10-8-9-10/h3-7,10,12H,2,8-9H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | BICUUDDOWKCEPK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |