C22H18N4OS — CID 51362394
N,N-diphenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 51362394) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is N,N-diphenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N,N-diphenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 51362394 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N,N-diphenyl-2-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ncn(-c2ccccc2)n1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N4OS/c27-21(16-28-22-23-17-25(24-22)18-10-4-1-5-11-18)26(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17H,16H2 |
| InChIKey | VZHRCIQVXUOBBT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |