C10H12N4S — CID 7730055
3-(2-phenylethylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 7730055) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-(2-phenylethylsulfanyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-phenylethylsulfanyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7730055 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(2-phenylethylsulfanyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1cnnc1SCCc1ccccc1 |
| InChI | InChI=1S/C10H12N4S/c11-14-8-12-13-10(14)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7,11H2 |
| InChIKey | VSTZXEHBLIXFJI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |