About 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine
3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 130979384) has the molecular formula C7H8N4S2
and a molecular weight of 212.30 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine.
Analyze 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine (CID 130979384) is 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine is Nn1cnnc1SCc1cccs1.
What is the InChIKey of 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine?
The InChIKey is HZKJDMIIFQIEAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S2/c8-11-5-9-10-7(11)13-4-6-2-1-3-12-6/h1-3,5H,4,8H2.
What are the key properties of 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine?
3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine has a molecular weight of 212.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiophen-2-ylmethylsulfanyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 130979384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).