C9H16N4O2S — CID 9378534
(2S)-N-(2-methoxyethyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 9378534) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is (2S)-N-(2-methoxyethyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-(2-methoxyethyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 9378534 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2S)-N-(2-methoxyethyl)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nncn1C |
| InChI | InChI=1S/C9H16N4O2S/c1-7(8(14)10-4-5-15-3)16-9-12-11-6-13(9)2/h6-7H,4-5H2,1-3H3,(H,10,14)/t7-/m0/s1 |
| InChIKey | ODUPYTOFTNNVLK-ZETCQYMHSA-N |
| XLogP | 0.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|