C10H19N5O2S — CID 63315233
2-[[5-(aminomethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide (PubChem CID 63315233) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[[5-(aminomethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[[5-(aminomethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 63315233 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[[5-(aminomethyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Sc1nnc(CN)n1C |
| InChI | InChI=1S/C10H19N5O2S/c1-7(9(16)12-4-5-17-3)18-10-14-13-8(6-11)15(10)2/h7H,4-6,11H2,1-3H3,(H,12,16) |
| InChIKey | HNPQSLSIALGDLH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|