About (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate
(4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate (PubChem CID 173408145) has the molecular formula C6H9N3OS2
and a molecular weight of 203.29 g/mol. Its IUPAC name is (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate.
Molecular Properties
| Compound Name | (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate |
| PubChem CID | 173408145 |
| Molecular Formula | C6H9N3OS2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate |
| SMILES | CC(O)C(=S)Sc1nncn1C |
| InChI | InChI=1S/C6H9N3OS2/c1-4(10)5(11)12-6-8-7-3-9(6)2/h3-4,10H,1-2H3 |
| InChIKey | OIMKZZDEZVCSTF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate?
The IUPAC name of (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate (CID 173408145) is (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate.
What is the SMILES notation for (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate?
The canonical SMILES for (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate is CC(O)C(=S)Sc1nncn1C.
What is the InChIKey of (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate?
The InChIKey is OIMKZZDEZVCSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3OS2/c1-4(10)5(11)12-6-8-7-3-9(6)2/h3-4,10H,1-2H3.
What are the key properties of (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate?
(4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate has a molecular weight of 203.29 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,2,4-triazol-3-yl) 2-hydroxypropanedithioate is sourced from PubChem (CID 173408145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).