C11H11N3O2S — CID 138109724
methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoate (PubChem CID 138109724) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoate.
| Compound Name | methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoate |
|---|---|
| PubChem CID | 138109724 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | methyl 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoate |
| SMILES | COC(=O)c1ccccc1Sc1nncn1C |
| InChI | InChI=1S/C11H11N3O2S/c1-14-7-12-13-11(14)17-9-6-4-3-5-8(9)10(15)16-2/h3-7H,1-2H3 |
| InChIKey | ALLBEOPDEUQKAQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |