About 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile (PubChem CID 28602383) has the molecular formula C10H8N4S
and a molecular weight of 216.27 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile.
Analyze 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile?
The IUPAC name of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile (CID 28602383) is 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile.
What is the SMILES notation for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile?
The canonical SMILES for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile is Cn1cnnc1Sc1ccccc1C#N.
What is the InChIKey of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile?
The InChIKey is ZWUMDDWHRDDFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4S/c1-14-7-12-13-10(14)15-9-5-3-2-4-8(9)6-11/h2-5,7H,1H3.
What are the key properties of 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile?
2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile has a molecular weight of 216.27 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzonitrile is sourced from PubChem (CID 28602383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).