C9H9N5O2S — CID 80883582
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitroaniline (PubChem CID 80883582) has the molecular formula C9H9N5O2S and a molecular weight of 251.27 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitroaniline.
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitroaniline |
|---|---|
| PubChem CID | 80883582 |
| Molecular Formula | C9H9N5O2S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-nitroaniline |
| SMILES | Cn1cnnc1Sc1cccc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O2S/c1-13-5-11-12-9(13)17-7-4-2-3-6(10)8(7)14(15)16/h2-5H,10H2,1H3 |
| InChIKey | KHORRTBZFMDDLU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|