C12H8N6O4S — CID 2871244
8-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dinitroquinoline (PubChem CID 2871244) has the molecular formula C12H8N6O4S and a molecular weight of 332.30 g/mol. Its IUPAC name is 8-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dinitroquinoline.
| Compound Name | 8-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dinitroquinoline |
|---|---|
| PubChem CID | 2871244 |
| Molecular Formula | C12H8N6O4S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 8-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-5,7-dinitroquinoline |
| SMILES | Cn1cnnc1Sc1c([N+](=O)[O-])cc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C12H8N6O4S/c1-16-6-14-15-12(16)23-11-9(18(21)22)5-8(17(19)20)7-3-2-4-13-10(7)11/h2-6H,1H3 |
| InChIKey | ZYAIWVMVQRTJMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 129.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|