C16H8N6O5S — CID 30023550
2-(5,7-dinitroquinolin-8-yl)sulfanyl-5-pyridin-3-yl-1,3,4-oxadiazole (PubChem CID 30023550) has the molecular formula C16H8N6O5S and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-(5,7-dinitroquinolin-8-yl)sulfanyl-5-pyridin-3-yl-1,3,4-oxadiazole.
| Compound Name | 2-(5,7-dinitroquinolin-8-yl)sulfanyl-5-pyridin-3-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 30023550 |
| Molecular Formula | C16H8N6O5S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-(5,7-dinitroquinolin-8-yl)sulfanyl-5-pyridin-3-yl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2cccnc2c1Sc1nnc(-c2cccnc2)o1 |
| InChI | InChI=1S/C16H8N6O5S/c23-21(24)11-7-12(22(25)26)14(13-10(11)4-2-6-18-13)28-16-20-19-15(27-16)9-3-1-5-17-8-9/h1-8H |
| InChIKey | CYFXLLMQTDNDOS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 150.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|