C14H10N4O3 — CID 556141
2-[(4-nitrophenyl)methyl]-5-pyridin-3-yl-1,3,4-oxadiazole (PubChem CID 556141) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-5-pyridin-3-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(4-nitrophenyl)methyl]-5-pyridin-3-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 556141 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-5-pyridin-3-yl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(Cc2nnc(-c3cccnc3)o2)cc1 |
| InChI | InChI=1S/C14H10N4O3/c19-18(20)12-5-3-10(4-6-12)8-13-16-17-14(21-13)11-2-1-7-15-9-11/h1-7,9H,8H2 |
| InChIKey | NJMLAXTUKPAYAT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|