C10H9N3O3 — CID 174693018
2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl formate (PubChem CID 174693018) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl formate.
| Compound Name | 2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl formate |
|---|---|
| PubChem CID | 174693018 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)ethyl formate |
| SMILES | O=COCCc1nnc(-c2cccnc2)o1 |
| InChI | InChI=1S/C10H9N3O3/c14-7-15-5-3-9-12-13-10(16-9)8-2-1-4-11-6-8/h1-2,4,6-7H,3,5H2 |
| InChIKey | KPVKONVYPKUFAU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|