C13H7ClN4O3S — CID 6493026
2-(3-chlorophenyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole (PubChem CID 6493026) has the molecular formula C13H7ClN4O3S and a molecular weight of 334.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chlorophenyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 6493026 |
| Molecular Formula | C13H7ClN4O3S |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccnc1Sc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C13H7ClN4O3S/c14-9-4-1-3-8(7-9)11-16-17-13(21-11)22-12-10(18(19)20)5-2-6-15-12/h1-7H |
| InChIKey | WSVNMBCDZLLREZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|