C10H7N7O3S — CID 2210613
2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-5-pyridin-3-yl-1,3,4-oxadiazole (PubChem CID 2210613) has the molecular formula C10H7N7O3S and a molecular weight of 305.28 g/mol. Its IUPAC name is 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-5-pyridin-3-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-5-pyridin-3-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2210613 |
| Molecular Formula | C10H7N7O3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-5-pyridin-3-yl-1,3,4-oxadiazole |
| SMILES | Cn1nc([N+](=O)[O-])nc1Sc1nnc(-c2cccnc2)o1 |
| InChI | InChI=1S/C10H7N7O3S/c1-16-9(12-8(15-16)17(18)19)21-10-14-13-7(20-10)6-3-2-4-11-5-6/h2-5H,1H3 |
| InChIKey | DGACIFQYIJPYQV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|