C6H7N3OS2 — CID 54472324
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial (PubChem CID 54472324) has the molecular formula C6H7N3OS2 and a molecular weight of 201.28 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial.
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial |
|---|---|
| PubChem CID | 54472324 |
| Molecular Formula | C6H7N3OS2 |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial |
| SMILES | Cn1cnnc1SCC(=O)C=S |
| InChI | InChI=1S/C6H7N3OS2/c1-9-4-7-8-6(9)12-3-5(10)2-11/h2,4H,3H2,1H3 |
| InChIKey | VXMOMNBMGXYNHW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|