About 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial (PubChem CID 54472324) has the molecular formula C6H7N3OS2
and a molecular weight of 201.28 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial.
Molecular Properties
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial |
| PubChem CID | 54472324 |
| Molecular Formula | C6H7N3OS2 |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial |
| SMILES | Cn1cnnc1SCC(=O)C=S |
| InChI | InChI=1S/C6H7N3OS2/c1-9-4-7-8-6(9)12-3-5(10)2-11/h2,4H,3H2,1H3 |
| InChIKey | VXMOMNBMGXYNHW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial?
The IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial (CID 54472324) is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial.
What is the SMILES notation for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial?
The canonical SMILES for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial is Cn1cnnc1SCC(=O)C=S.
What is the InChIKey of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial?
The InChIKey is VXMOMNBMGXYNHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3OS2/c1-9-4-7-8-6(9)12-3-5(10)2-11/h2,4H,3H2,1H3.
What are the key properties of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial?
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial has a molecular weight of 201.28 g/mol, XLogP of 0.48, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-2-oxopropanethial is sourced from PubChem (CID 54472324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).