C8H11N3O2S — CID 76975123
3-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enoic acid (PubChem CID 76975123) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 3-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enoic acid.
| Compound Name | 3-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enoic acid |
|---|---|
| PubChem CID | 76975123 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-methyl-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CSc1nncn1C |
| InChI | InChI=1S/C8H11N3O2S/c1-6(3-7(12)13)4-14-8-10-9-5-11(8)2/h3,5H,4H2,1-2H3,(H,12,13) |
| InChIKey | BRLOKOGCOZLXNU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|