C16H13F2N3S — CID 47004082
3-[bis(4-fluorophenyl)methylsulfanyl]-4-methyl-1,2,4-triazole (PubChem CID 47004082) has the molecular formula C16H13F2N3S and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-[bis(4-fluorophenyl)methylsulfanyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[bis(4-fluorophenyl)methylsulfanyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 47004082 |
| Molecular Formula | C16H13F2N3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-[bis(4-fluorophenyl)methylsulfanyl]-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1SC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13F2N3S/c1-21-10-19-20-16(21)22-15(11-2-6-13(17)7-3-11)12-4-8-14(18)9-5-12/h2-10,15H,1H3 |
| InChIKey | DRHGEYVRNBEVFS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |