C11H13FN4O2S2 — CID 135347426
4-fluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide (PubChem CID 135347426) has the molecular formula C11H13FN4O2S2 and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-fluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135347426 |
| Molecular Formula | C11H13FN4O2S2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-fluoro-N-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
| SMILES | Cn1cnnc1SCCNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN4O2S2/c1-16-8-13-15-11(16)19-7-6-14-20(17,18)10-4-2-9(12)3-5-10/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | DFORRMCYBDEEPK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|