C12H15N3O2S2 — CID 51204540
N-[2-(1-methylimidazol-2-yl)sulfanylethyl]benzenesulfonamide (PubChem CID 51204540) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)sulfanylethyl]benzenesulfonamide.
| Compound Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51204540 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)sulfanylethyl]benzenesulfonamide |
| SMILES | Cn1ccnc1SCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-15-9-7-13-12(15)18-10-8-14-19(16,17)11-5-3-2-4-6-11/h2-7,9,14H,8,10H2,1H3 |
| InChIKey | RPUAODFOXCITLH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|