About N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide
N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide (PubChem CID 51091381) has the molecular formula C13H16N4O2S2
and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
| PubChem CID | 51091381 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
| SMILES | C=CCn1cnnc1SCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-2-9-17-11-14-16-13(17)20-10-8-15-21(18,19)12-6-4-3-5-7-12/h2-7,11,15H,1,8-10H2 |
| InChIKey | KNNXJZUBIHMPCM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide?
The IUPAC name of N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide (CID 51091381) is N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide?
The canonical SMILES for N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide is C=CCn1cnnc1SCCNS(=O)(=O)c1ccccc1.
What is the InChIKey of N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide?
The InChIKey is KNNXJZUBIHMPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S2/c1-2-9-17-11-14-16-13(17)20-10-8-15-21(18,19)12-6-4-3-5-7-12/h2-7,11,15H,1,8-10H2.
What are the key properties of N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide?
N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide has a molecular weight of 324.43 g/mol, XLogP of 1.53, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide is sourced from PubChem (CID 51091381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).