C13H16N4O2S2 — CID 51091381
N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide (PubChem CID 51091381) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51091381 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]benzenesulfonamide |
| SMILES | C=CCn1cnnc1SCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16N4O2S2/c1-2-9-17-11-14-16-13(17)20-10-8-15-21(18,19)12-6-4-3-5-7-12/h2-7,11,15H,1,8-10H2 |
| InChIKey | KNNXJZUBIHMPCM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|