C11H18N4OS — CID 9374304
N-tert-butyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 9374304) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is N-tert-butyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-tert-butyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9374304 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-tert-butyl-2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1cnnc1SCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H18N4OS/c1-5-6-15-8-12-14-10(15)17-7-9(16)13-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,13,16) |
| InChIKey | WWDNNNRRHULZEA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|