C14H13F3N4OS — CID 30554443
2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 30554443) has the molecular formula C14H13F3N4OS and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30554443 |
| Molecular Formula | C14H13F3N4OS |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=CCn1cnnc1SCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N4OS/c1-2-7-21-9-18-20-13(21)23-8-12(22)19-11-6-4-3-5-10(11)14(15,16)17/h2-6,9H,1,7-8H2,(H,19,22) |
| InChIKey | CVXNDCKVBDRATQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|