C13H15N5O3S2 — CID 30554690
2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 30554690) has the molecular formula C13H15N5O3S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 30554690 |
| Molecular Formula | C13H15N5O3S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | C=CCn1cnnc1SCC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H15N5O3S2/c1-2-6-18-9-15-17-13(18)22-8-12(19)16-10-4-3-5-11(7-10)23(14,20)21/h2-5,7,9H,1,6,8H2,(H,16,19)(H2,14,20,21) |
| InChIKey | CKEOJJUINHSCEO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|